CAS 1170602-50-2 appears in our catalog under these names: 2-(2,4-Dichloro-3,5-dimethylphenoxy)ethanamine hydrochloride, 97%, [2-(2,4-Dichloro-3,5-dimethylphenoxy)ethyl]amine hydrochloride, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(2,4-dichloro-3,5-dimethylphenoxy)ethanamine;hydrochloride (CAS 1170602-50-2) is a chemical compound with the molecular formula C10H14Cl3NO and a molecular weight of 270.6 g/mol. IUPAC name: 2-(2,4-dichloro-3,5-dimethylphenoxy)ethanamine;hydrochloride. InChIKey: LYIXNBNJZAGQRN-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl3NO |
|---|---|
| Molecular weight | 270.6 g/mol |
| IUPAC name | 2-(2,4-dichloro-3,5-dimethylphenoxy)ethanamine;hydrochloride |
| InChIKey | LYIXNBNJZAGQRN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1Cl)C)Cl)OCCN.Cl |
Computed by PubChem (NCBI)