CAS 1803587-38-3 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)-3-methoxypropan-1-amine hydrochloride, 1-(3,4-Dichlorophenyl)-3-methoxypropan-1-amine hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-(3,4-dichlorophenyl)-3-methoxypropan-1-amine;hydrochloride (CAS 1803587-38-3) is a chemical compound with the molecular formula C10H14Cl3NO and a molecular weight of 270.6 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-3-methoxypropan-1-amine;hydrochloride. InChIKey: OAXBWDOISOVERG-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl3NO |
|---|---|
| Molecular weight | 270.6 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-3-methoxypropan-1-amine;hydrochloride |
| InChIKey | OAXBWDOISOVERG-UHFFFAOYSA-N |
| SMILES | COCCC(C1=CC(=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)