Products 1170719-60-4

CAS 1170719-60-4 is the registry number for Methyl 4-Aminofuran-2-carboxylate Hydrochloride, >95%, >95%. Offered by: Chemat. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

Methyl 4-aminofuran-2-carboxylate;hydrochloride (CAS 1170719-60-4) is a chemical compound with the molecular formula C6H8ClNO3 and a molecular weight of 177.58 g/mol. IUPAC name: methyl 4-aminofuran-2-carboxylate;hydrochloride. InChIKey: SQURBBCBEXWWAF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8ClNO3
Molecular weight177.58 g/mol
IUPAC namemethyl 4-aminofuran-2-carboxylate;hydrochloride
InChIKeySQURBBCBEXWWAF-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=CO1)N.Cl

Computed by PubChem (NCBI)