Products 944467-87-2

CAS 944467-87-2 is the registry number for 3-(Aminomethyl)furan-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,05g, 0,1g, 0,25g, 1g, 0,5g.

Structural formula: {0} (CAS {1})

3-(aminomethyl)furan-2-carboxylic acid;hydrochloride (CAS 944467-87-2) is a chemical compound with the molecular formula C6H8ClNO3 and a molecular weight of 177.58 g/mol. IUPAC name: 3-(aminomethyl)furan-2-carboxylic acid;hydrochloride. InChIKey: OQKOZKIBMKSAHU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8ClNO3
Molecular weight177.58 g/mol
IUPAC name3-(aminomethyl)furan-2-carboxylic acid;hydrochloride
InChIKeyOQKOZKIBMKSAHU-UHFFFAOYSA-N
SMILESC1=COC(=C1CN)C(=O)O.Cl

Computed by PubChem (NCBI)