Products 1170804-87-1

CAS 1170804-87-1 is the registry number for 4-(4-Chloro-3-methyl-5-nitro-1h-pyrazol-1-yl)butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(4-chloro-3-methyl-5-nitropyrazol-1-yl)butanoic acid (CAS 1170804-87-1) is a chemical compound with the molecular formula C8H10ClN3O4 and a molecular weight of 247.63 g/mol. IUPAC name: 4-(4-chloro-3-methyl-5-nitropyrazol-1-yl)butanoic acid. InChIKey: XDVITRSDRWVJJT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClN3O4
Molecular weight247.63 g/mol
IUPAC name4-(4-chloro-3-methyl-5-nitropyrazol-1-yl)butanoic acid
InChIKeyXDVITRSDRWVJJT-UHFFFAOYSA-N
SMILESCC1=NN(C(=C1Cl)[N+](=O)[O-])CCCC(=O)O

Computed by PubChem (NCBI)