Products 91828-76-1
CAS 91828-76-1 is the registry number for 2-(2,4-Dinitrophenyl)ethan-1-amine hydrochloride, 99%, 99%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(2,4-dinitrophenyl)ethanamine;hydrochloride (CAS 91828-76-1) is a chemical compound with the molecular formula C8H10ClN3O4 and a molecular weight of 247.63 g/mol. IUPAC name: 2-(2,4-dinitrophenyl)ethanamine;hydrochloride. InChIKey: UVAXTLQWSLRCEU-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O4 |
|---|---|
| Molecular weight | 247.63 g/mol |
| IUPAC name | 2-(2,4-dinitrophenyl)ethanamine;hydrochloride |
| InChIKey | UVAXTLQWSLRCEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])CCN.Cl |
Computed by PubChem (NCBI)