CAS 117087-84-0 appears in our catalog under these names: 2-Amino-N-(cyanomethyl)acetamide, methanesulfonic acid, 95%, 2-Amino-N-(cyanomethyl)acetamide methanesulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-amino-N-(cyanomethyl)acetamide;methanesulfonic acid (CAS 117087-84-0) is a chemical compound with the molecular formula C5H11N3O4S and a molecular weight of 209.23 g/mol. IUPAC name: 2-amino-N-(cyanomethyl)acetamide;methanesulfonic acid. InChIKey: YIBFIYVLZLUVRW-UHFFFAOYSA-N.
| Molecular formula | C5H11N3O4S |
|---|---|
| Molecular weight | 209.23 g/mol |
| IUPAC name | 2-amino-N-(cyanomethyl)acetamide;methanesulfonic acid |
| InChIKey | YIBFIYVLZLUVRW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C(C#N)NC(=O)CN |
Computed by PubChem (NCBI)