Products 1170938-91-6
CAS 1170938-91-6 is the registry number for 3-Chloro-4-(2-methylpropoxy)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-chloro-4-(2-methylpropoxy)aniline;hydrochloride (CAS 1170938-91-6) is a chemical compound with the molecular formula C10H15Cl2NO and a molecular weight of 236.13 g/mol. IUPAC name: 3-chloro-4-(2-methylpropoxy)aniline;hydrochloride. InChIKey: RLVAVQDABPTUAD-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2NO |
|---|---|
| Molecular weight | 236.13 g/mol |
| IUPAC name | 3-chloro-4-(2-methylpropoxy)aniline;hydrochloride |
| InChIKey | RLVAVQDABPTUAD-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=C(C=C(C=C1)N)Cl.Cl |
Computed by PubChem (NCBI)