CAS 1171061-94-1 appears in our catalog under these names: 3-(Pyridin-2-ylmethanesulfonyl)propanoic acid hydrochloride, 95%, 3-(Pyridin-2-ylmethanesulfonyl)propanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-(pyridin-2-ylmethylsulfonyl)propanoic acid;hydrochloride (CAS 1171061-94-1) is a chemical compound with the molecular formula C9H12ClNO4S and a molecular weight of 265.71 g/mol. IUPAC name: 3-(pyridin-2-ylmethylsulfonyl)propanoic acid;hydrochloride. InChIKey: QDYBHCHDGKWOGI-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO4S |
|---|---|
| Molecular weight | 265.71 g/mol |
| IUPAC name | 3-(pyridin-2-ylmethylsulfonyl)propanoic acid;hydrochloride |
| InChIKey | QDYBHCHDGKWOGI-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CS(=O)(=O)CCC(=O)O.Cl |
Computed by PubChem (NCBI)