CAS 368869-88-9 appears in our catalog under these names: Ethyl 4–(chlorosulphonyl)–3,5–dimethyl–1H–pyrrole–2–carboxylate, Ethyl 4-(chlorosulfonyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate 97%, Ethyl 4-(chlorosulfonyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate, ≥97%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg.
Ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (CAS 368869-88-9) is a chemical compound with the molecular formula C9H12ClNO4S and a molecular weight of 265.71 g/mol. IUPAC name: ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate. InChIKey: IRBVAHDFENUACC-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO4S |
|---|---|
| Molecular weight | 265.71 g/mol |
| IUPAC name | ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| InChIKey | IRBVAHDFENUACC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(N1)C)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)