Products 1171069-08-1
CAS 1171069-08-1 appears in our catalog under these names: [1-(3,4-Dichlorophenyl)ethyl](propyl)amine hydrochloride, 95%, (1-(3,4-Dichlorophenyl)ethyl)(propyl)amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-[1-(3,4-dichlorophenyl)ethyl]propan-1-amine;hydrochloride (CAS 1171069-08-1) is a chemical compound with the molecular formula C11H16Cl3N and a molecular weight of 268.6 g/mol. IUPAC name: N-[1-(3,4-dichlorophenyl)ethyl]propan-1-amine;hydrochloride. InChIKey: ZWWRVMHAWGIATM-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl3N |
|---|---|
| Molecular weight | 268.6 g/mol |
| IUPAC name | N-[1-(3,4-dichlorophenyl)ethyl]propan-1-amine;hydrochloride |
| InChIKey | ZWWRVMHAWGIATM-UHFFFAOYSA-N |
| SMILES | CCCNC(C)C1=CC(=C(C=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)