CAS 953789-37-2 appears in our catalog under these names: 4-Chloro-N-(2-chloropropyl)benzeneethanamine Hydrochloride, 2-Chloro-n-(4-chlorophenethyl)propan-1-amine, 95%, Lorcaserin Impurity B HCl, 2-Chloro-N-(4-chlorophenethyl)propan-1-amine hydrochloride, 98%, 98%, 2-Chloro-N-(4-chlorophenethyl)propan-1-amine hydrochloride, 98%. Offered by: TRC, Combi-blocks, Chemat Brand, Chemat, Fluorochem. Available pack sizes: 50mg, 1g, 5g, on request, 100mg, 250mg, 10g.
2-chloro-N-[2-(4-chlorophenyl)ethyl]propan-1-amine;hydrochloride (CAS 953789-37-2) is a chemical compound with the molecular formula C11H16Cl3N and a molecular weight of 268.6 g/mol. IUPAC name: 2-chloro-N-[2-(4-chlorophenyl)ethyl]propan-1-amine;hydrochloride. InChIKey: ARSNVFGYXNWTPK-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl3N |
|---|---|
| Molecular weight | 268.6 g/mol |
| IUPAC name | 2-chloro-N-[2-(4-chlorophenyl)ethyl]propan-1-amine;hydrochloride |
| InChIKey | ARSNVFGYXNWTPK-UHFFFAOYSA-N |
| SMILES | CC(CNCCC1=CC=C(C=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)