Products 1171203-11-4

CAS 1171203-11-4 is the registry number for 2-(4-Amino-3-(trifluoromethyl)-1H-pyrazol-1-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[4-amino-3-(trifluoromethyl)pyrazol-1-yl]butanoic acid (CAS 1171203-11-4) is a chemical compound with the molecular formula C8H10F3N3O2 and a molecular weight of 237.18 g/mol. IUPAC name: 2-[4-amino-3-(trifluoromethyl)pyrazol-1-yl]butanoic acid. InChIKey: ITISNELBHGXFPF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10F3N3O2
Molecular weight237.18 g/mol
IUPAC name2-[4-amino-3-(trifluoromethyl)pyrazol-1-yl]butanoic acid
InChIKeyITISNELBHGXFPF-UHFFFAOYSA-N
SMILESCCC(C(=O)O)N1C=C(C(=N1)C(F)(F)F)N

Computed by PubChem (NCBI)