CAS 2344679-51-0 is the registry number for (3-Methylpyrazin-2-yl)methanamine 2,2,2-trifluoroacetate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
(3-methylpyrazin-2-yl)methanamine;2,2,2-trifluoroacetic acid (CAS 2344679-51-0) is a chemical compound with the molecular formula C8H10F3N3O2 and a molecular weight of 237.18 g/mol. IUPAC name: (3-methylpyrazin-2-yl)methanamine;2,2,2-trifluoroacetic acid. InChIKey: JCXNXMREDWGTMF-UHFFFAOYSA-N.
| Molecular formula | C8H10F3N3O2 |
|---|---|
| Molecular weight | 237.18 g/mol |
| IUPAC name | (3-methylpyrazin-2-yl)methanamine;2,2,2-trifluoroacetic acid |
| InChIKey | JCXNXMREDWGTMF-UHFFFAOYSA-N |
| SMILES | CC1=NC=CN=C1CN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)