Products 1171317-52-4

CAS 1171317-52-4 is the registry number for 1-(4-Fluoro-benzyl)-5-oxo-pyrrolidine-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 1-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylate (CAS 1171317-52-4) is a chemical compound with the molecular formula C13H14FNO3 and a molecular weight of 251.25 g/mol. IUPAC name: methyl 1-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylate. InChIKey: PEFRKIAHTKYYKV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14FNO3
Molecular weight251.25 g/mol
IUPAC namemethyl 1-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylate
InChIKeyPEFRKIAHTKYYKV-UHFFFAOYSA-N
SMILESCOC(=O)C1CC(=O)N(C1)CC2=CC=C(C=C2)F

Computed by PubChem (NCBI)