Products 842971-84-0

CAS 842971-84-0 is the registry number for 1-[2-(4-Fluorophenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

1-[2-(4-fluorophenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 842971-84-0) is a chemical compound with the molecular formula C13H14FNO3 and a molecular weight of 251.25 g/mol. IUPAC name: 1-[2-(4-fluorophenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: JEJKVDIMYSYXMU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14FNO3
Molecular weight251.25 g/mol
IUPAC name1-[2-(4-fluorophenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid
InChIKeyJEJKVDIMYSYXMU-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)CCC2=CC=C(C=C2)F)C(=O)O

Computed by PubChem (NCBI)