CAS 1171325-50-0 appears in our catalog under these names: 2-(4-[(4-Methylbenzene)sulfonyl]piperazin-1-yl)acetic acid hydrochloride, 95%, 2-(4-Tosylpiperazin-1-yl)acetic acid hydrochloride, 97%, 2-(4-(4-Methylbenzenesulfonyl)piperazin-1-yl)acetic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 2,5g.
2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetic acid;hydrochloride (CAS 1171325-50-0) is a chemical compound with the molecular formula C13H19ClN2O4S and a molecular weight of 334.82 g/mol. IUPAC name: 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetic acid;hydrochloride. InChIKey: ZRGCLEKXOSMGHI-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O4S |
|---|---|
| Molecular weight | 334.82 g/mol |
| IUPAC name | 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetic acid;hydrochloride |
| InChIKey | ZRGCLEKXOSMGHI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)CC(=O)O.Cl |
Computed by PubChem (NCBI)