CAS 1286272-68-1 appears in our catalog under these names: Methyl 3-[(piperidin-4-yl)sulfamoyl]benzoate hydrochloride, 95%, Methyl 3-((piperidin-4-yl)sulfamoyl)benzoate hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
Methyl 3-(piperidin-4-ylsulfamoyl)benzoate;hydrochloride (CAS 1286272-68-1) is a chemical compound with the molecular formula C13H19ClN2O4S and a molecular weight of 334.82 g/mol. IUPAC name: methyl 3-(piperidin-4-ylsulfamoyl)benzoate;hydrochloride. InChIKey: IZDCUFYHSIADMT-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O4S |
|---|---|
| Molecular weight | 334.82 g/mol |
| IUPAC name | methyl 3-(piperidin-4-ylsulfamoyl)benzoate;hydrochloride |
| InChIKey | IZDCUFYHSIADMT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)S(=O)(=O)NC2CCNCC2.Cl |
Computed by PubChem (NCBI)