CAS 1171382-53-8 appears in our catalog under these names: 3-(Cyclopentyloxy)aniline hydrochloride, 95%, 3-(Cyclopentyloxy)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g.
3-cyclopentyloxyaniline;hydrochloride (CAS 1171382-53-8) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 3-cyclopentyloxyaniline;hydrochloride. InChIKey: JEWIYCICDLLCEF-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 3-cyclopentyloxyaniline;hydrochloride |
| InChIKey | JEWIYCICDLLCEF-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=CC=CC(=C2)N.Cl |
Computed by PubChem (NCBI)