CAS 1171562-15-4 is the registry number for ((2-Nitrophenyl)methyl)(2,2,2-trifluoroethyl)amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,2,2-trifluoro-N-[(2-nitrophenyl)methyl]ethanamine;hydrochloride (CAS 1171562-15-4) is a chemical compound with the molecular formula C9H10ClF3N2O2 and a molecular weight of 270.63 g/mol. IUPAC name: 2,2,2-trifluoro-N-[(2-nitrophenyl)methyl]ethanamine;hydrochloride. InChIKey: FEKBSAJDRINKOZ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF3N2O2 |
|---|---|
| Molecular weight | 270.63 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[(2-nitrophenyl)methyl]ethanamine;hydrochloride |
| InChIKey | FEKBSAJDRINKOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNCC(F)(F)F)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)