Products 1956318-15-2
CAS 1956318-15-2 is the registry number for Ethyl 5-chloro-1-(3,3,3-trifluoropropyl)-1h-pyrazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Ethyl 5-chloro-1-(3,3,3-trifluoropropyl)pyrazole-4-carboxylate (CAS 1956318-15-2) is a chemical compound with the molecular formula C9H10ClF3N2O2 and a molecular weight of 270.63 g/mol. IUPAC name: ethyl 5-chloro-1-(3,3,3-trifluoropropyl)pyrazole-4-carboxylate. InChIKey: OBKORRTUBFHQMZ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF3N2O2 |
|---|---|
| Molecular weight | 270.63 g/mol |
| IUPAC name | ethyl 5-chloro-1-(3,3,3-trifluoropropyl)pyrazole-4-carboxylate |
| InChIKey | OBKORRTUBFHQMZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)CCC(F)(F)F)Cl |
Computed by PubChem (NCBI)