CAS 117160-99-3 appears in our catalog under these names: (S)-(+)-2-Amino-3-cyclohexyl-1-propanol hydrochloride, 98%, (S)-2-Amino-3-cyclohexylpropan-1-ol hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
(2S)-2-amino-3-cyclohexylpropan-1-ol;hydrochloride (CAS 117160-99-3) is a chemical compound with the molecular formula C9H20ClNO and a molecular weight of 193.71 g/mol. IUPAC name: (2S)-2-amino-3-cyclohexylpropan-1-ol;hydrochloride. InChIKey: BMHYDTXNZNVADC-FVGYRXGTSA-N.
| Molecular formula | C9H20ClNO |
|---|---|
| Molecular weight | 193.71 g/mol |
| IUPAC name | (2S)-2-amino-3-cyclohexylpropan-1-ol;hydrochloride |
| InChIKey | BMHYDTXNZNVADC-FVGYRXGTSA-N |
| SMILES | C1CCC(CC1)C[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)