Products 1212377-79-1
CAS 1212377-79-1 is the registry number for Cis-(2-methyl-2-methylamino-cyclohexyl)-methanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[(1R,2S)-2-methyl-2-(methylamino)cyclohexyl]methanol;hydrochloride (CAS 1212377-79-1) is a chemical compound with the molecular formula C9H20ClNO and a molecular weight of 193.71 g/mol. IUPAC name: [(1R,2S)-2-methyl-2-(methylamino)cyclohexyl]methanol;hydrochloride. InChIKey: XXXPITZKQGKERU-OZZZDHQUSA-N.
| Molecular formula | C9H20ClNO |
|---|---|
| Molecular weight | 193.71 g/mol |
| IUPAC name | [(1R,2S)-2-methyl-2-(methylamino)cyclohexyl]methanol;hydrochloride |
| InChIKey | XXXPITZKQGKERU-OZZZDHQUSA-N |
| SMILES | C[C@@]1(CCCC[C@H]1CO)NC.Cl |
Computed by PubChem (NCBI)