CAS 1171728-14-5 appears in our catalog under these names: 2-Amino-6-bromo-3-methylquinoline hydrochloride, 96%, 6-Bromo-3-methylquinolin-2-amine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
6-bromo-3-methylquinolin-2-amine;hydrochloride (CAS 1171728-14-5) is a chemical compound with the molecular formula C10H10BrClN2 and a molecular weight of 273.55 g/mol. IUPAC name: 6-bromo-3-methylquinolin-2-amine;hydrochloride. InChIKey: AMMCNIUMBAUXPY-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClN2 |
|---|---|
| Molecular weight | 273.55 g/mol |
| IUPAC name | 6-bromo-3-methylquinolin-2-amine;hydrochloride |
| InChIKey | AMMCNIUMBAUXPY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2)Br)N=C1N.Cl |
Computed by PubChem (NCBI)