CAS 1820613-06-6 is the registry number for 6-Bromonaphthalene-1,2-diamine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-bromonaphthalene-1,2-diamine;hydrochloride (CAS 1820613-06-6) is a chemical compound with the molecular formula C10H10BrClN2 and a molecular weight of 273.55 g/mol. IUPAC name: 6-bromonaphthalene-1,2-diamine;hydrochloride. InChIKey: IBSVBTMVUYTVEV-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClN2 |
|---|---|
| Molecular weight | 273.55 g/mol |
| IUPAC name | 6-bromonaphthalene-1,2-diamine;hydrochloride |
| InChIKey | IBSVBTMVUYTVEV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N)N)C=C1Br.Cl |
Computed by PubChem (NCBI)