CAS 117181-61-0 is the registry number for (4S,5S)-2,2,5-Trimethyl-1,3-dioxolane-4-carboxylic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg.
Methyl (4S,5S)-2,2,5-trimethyl-1,3-dioxolane-4-carboxylate (CAS 117181-61-0) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 174.19 g/mol. IUPAC name: methyl (4S,5S)-2,2,5-trimethyl-1,3-dioxolane-4-carboxylate. InChIKey: AELKYRWKHKGMAD-WDSKDSINSA-N.
| Molecular formula | C8H14O4 |
|---|---|
| Molecular weight | 174.19 g/mol |
| IUPAC name | methyl (4S,5S)-2,2,5-trimethyl-1,3-dioxolane-4-carboxylate |
| InChIKey | AELKYRWKHKGMAD-WDSKDSINSA-N |
| SMILES | C[C@H]1[C@H](OC(O1)(C)C)C(=O)OC |
Computed by PubChem (NCBI)