Products 1171824-18-2
CAS 1171824-18-2 appears in our catalog under these names: 4-Fluoro-5-iodo-2-methoxybenzoic acid, 97%, 4-Fluoro-5-iodo-2-methoxy-benzoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g.
4-fluoro-5-iodo-2-methoxybenzoic acid (CAS 1171824-18-2) is a chemical compound with the molecular formula C8H6FIO3 and a molecular weight of 296.03 g/mol. IUPAC name: 4-fluoro-5-iodo-2-methoxybenzoic acid. InChIKey: JXXMPOAKJVXLKZ-UHFFFAOYSA-N.
| Molecular formula | C8H6FIO3 |
|---|---|
| Molecular weight | 296.03 g/mol |
| IUPAC name | 4-fluoro-5-iodo-2-methoxybenzoic acid |
| InChIKey | JXXMPOAKJVXLKZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)I)F |
Computed by PubChem (NCBI)