Products 935660-89-2
CAS 935660-89-2 appears in our catalog under these names: 2-Fluoro-6-iodo-3-methoxybenzoic acid, 95%, Benzoic acid, 2-fluoro-6-iodo-3-methoxy-, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-fluoro-6-iodo-3-methoxybenzoic acid (CAS 935660-89-2) is a chemical compound with the molecular formula C8H6FIO3 and a molecular weight of 296.03 g/mol. IUPAC name: 2-fluoro-6-iodo-3-methoxybenzoic acid. InChIKey: LQCQGKYUMOOPKX-UHFFFAOYSA-N.
| Molecular formula | C8H6FIO3 |
|---|---|
| Molecular weight | 296.03 g/mol |
| IUPAC name | 2-fluoro-6-iodo-3-methoxybenzoic acid |
| InChIKey | LQCQGKYUMOOPKX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)I)C(=O)O)F |
Computed by PubChem (NCBI)