CAS 1171833-94-5 is the registry number for 5-(tert-Butyl) 3-methyl 2,4,6,7-tetrahydro-5H-pyrazolo[4,3-c]pyridine-3,5-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-O-tert-butyl 3-O-methyl 1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxylate (CAS 1171833-94-5) is a chemical compound with the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. IUPAC name: 5-O-tert-butyl 3-O-methyl 1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxylate. InChIKey: FUZVEBMAZNTZEQ-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O4 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | 5-O-tert-butyl 3-O-methyl 1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxylate |
| InChIKey | FUZVEBMAZNTZEQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C(=NN2)C(=O)OC |
Computed by PubChem (NCBI)