CAS 1171924-81-4 is the registry number for Methyl 2-(2,4-dichlorophenethyl)-6-hydroxybenzoate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[2-(2,4-dichlorophenyl)ethyl]-6-hydroxybenzoate (CAS 1171924-81-4) is a chemical compound with the molecular formula C16H14Cl2O3 and a molecular weight of 325.2 g/mol. IUPAC name: methyl 2-[2-(2,4-dichlorophenyl)ethyl]-6-hydroxybenzoate. InChIKey: JXQJOPWRSZPKGK-UHFFFAOYSA-N.
| Molecular formula | C16H14Cl2O3 |
|---|---|
| Molecular weight | 325.2 g/mol |
| IUPAC name | methyl 2-[2-(2,4-dichlorophenyl)ethyl]-6-hydroxybenzoate |
| InChIKey | JXQJOPWRSZPKGK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=C1O)CCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)