CAS 40689-39-2 appears in our catalog under these names: Ethyl 4-(benzyloxy)-3,5-dichlorobenzoate, 95%, Ethyl 4-(benzyloxy)-3,5-dichlorobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
Ethyl 3,5-dichloro-4-phenylmethoxybenzoate (CAS 40689-39-2) is a chemical compound with the molecular formula C16H14Cl2O3 and a molecular weight of 325.2 g/mol. IUPAC name: ethyl 3,5-dichloro-4-phenylmethoxybenzoate. InChIKey: NKUXAJALKKVYQV-UHFFFAOYSA-N.
| Molecular formula | C16H14Cl2O3 |
|---|---|
| Molecular weight | 325.2 g/mol |
| IUPAC name | ethyl 3,5-dichloro-4-phenylmethoxybenzoate |
| InChIKey | NKUXAJALKKVYQV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)Cl)OCC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)