Products 1171935-75-3

CAS 1171935-75-3 is the registry number for 7-Chloro-4-trifluoromethyl-1H-indole-2-carboxylic acid ethyl ester, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 7-chloro-4-(trifluoromethyl)-1H-indole-2-carboxylate (CAS 1171935-75-3) is a chemical compound with the molecular formula C12H9ClF3NO2 and a molecular weight of 291.65 g/mol. IUPAC name: ethyl 7-chloro-4-(trifluoromethyl)-1H-indole-2-carboxylate. InChIKey: LZAVZQMRWIRPHF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9ClF3NO2
Molecular weight291.65 g/mol
IUPAC nameethyl 7-chloro-4-(trifluoromethyl)-1H-indole-2-carboxylate
InChIKeyLZAVZQMRWIRPHF-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC2=C(C=CC(=C2N1)Cl)C(F)(F)F

Computed by PubChem (NCBI)