CAS 1171935-75-3 is the registry number for 7-Chloro-4-trifluoromethyl-1H-indole-2-carboxylic acid ethyl ester, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 7-chloro-4-(trifluoromethyl)-1H-indole-2-carboxylate (CAS 1171935-75-3) is a chemical compound with the molecular formula C12H9ClF3NO2 and a molecular weight of 291.65 g/mol. IUPAC name: ethyl 7-chloro-4-(trifluoromethyl)-1H-indole-2-carboxylate. InChIKey: LZAVZQMRWIRPHF-UHFFFAOYSA-N.
| Molecular formula | C12H9ClF3NO2 |
|---|---|
| Molecular weight | 291.65 g/mol |
| IUPAC name | ethyl 7-chloro-4-(trifluoromethyl)-1H-indole-2-carboxylate |
| InChIKey | LZAVZQMRWIRPHF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=CC(=C2N1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)