CAS 2718971-71-0 is the registry number for 4-Chloro-6,7-dimethoxy-3-(trifluoromethyl)quinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-6,7-dimethoxy-3-(trifluoromethyl)quinoline (CAS 2718971-71-0) is a chemical compound with the molecular formula C12H9ClF3NO2 and a molecular weight of 291.65 g/mol. IUPAC name: 4-chloro-6,7-dimethoxy-3-(trifluoromethyl)quinoline. InChIKey: MFOSKHLMYARTRT-UHFFFAOYSA-N.
| Molecular formula | C12H9ClF3NO2 |
|---|---|
| Molecular weight | 291.65 g/mol |
| IUPAC name | 4-chloro-6,7-dimethoxy-3-(trifluoromethyl)quinoline |
| InChIKey | MFOSKHLMYARTRT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=C(C=N2)C(F)(F)F)Cl)OC |
Computed by PubChem (NCBI)