CAS 117196-08-4 is the registry number for 2,4-Dibromopyridine 1-oxide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dibromo-1-oxidopyridin-1-ium (CAS 117196-08-4) is a chemical compound with the molecular formula C5H3Br2NO and a molecular weight of 252.89 g/mol. IUPAC name: 2,4-dibromo-1-oxidopyridin-1-ium. InChIKey: HLTHDBIDRZSXAV-UHFFFAOYSA-N.
| Molecular formula | C5H3Br2NO |
|---|---|
| Molecular weight | 252.89 g/mol |
| IUPAC name | 2,4-dibromo-1-oxidopyridin-1-ium |
| InChIKey | HLTHDBIDRZSXAV-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=C(C=C1Br)Br)[O-] |
Computed by PubChem (NCBI)