CAS 1172004-02-2 is the registry number for 1-((3-Phenyl-1,2,4-oxadiazol-5-yl)methyl)piperazine dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-phenyl-5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole;dihydrochloride (CAS 1172004-02-2) is a chemical compound with the molecular formula C13H18Cl2N4O and a molecular weight of 317.21 g/mol. IUPAC name: 3-phenyl-5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole;dihydrochloride. InChIKey: GMWBSCUDOVLYBE-UHFFFAOYSA-N.
| Molecular formula | C13H18Cl2N4O |
|---|---|
| Molecular weight | 317.21 g/mol |
| IUPAC name | 3-phenyl-5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole;dihydrochloride |
| InChIKey | GMWBSCUDOVLYBE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=NC(=NO2)C3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)