CAS 1172391-60-4 is the registry number for 2-((3-(Trifluoromethyl)phenyl)amino)-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
2-[3-(trifluoromethyl)anilino]-1,3-thiazole-4-carboxylic acid (CAS 1172391-60-4) is a chemical compound with the molecular formula C11H7F3N2O2S and a molecular weight of 288.25 g/mol. IUPAC name: 2-[3-(trifluoromethyl)anilino]-1,3-thiazole-4-carboxylic acid. InChIKey: GBFOFKLNZUYKJG-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O2S |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)anilino]-1,3-thiazole-4-carboxylic acid |
| InChIKey | GBFOFKLNZUYKJG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC2=NC(=CS2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)