Products 1518437-53-0

CAS 1518437-53-0 appears in our catalog under these names: 2-((4-(Trifluoromethyl)phenyl)amino)thiazole-5-carboxylic acid 95%, 2-((4-(Trifluoromethyl)phenyl)amino)thiazole-5-carboxylic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[4-(trifluoromethyl)anilino]-1,3-thiazole-5-carboxylic acid (CAS 1518437-53-0) is a chemical compound with the molecular formula C11H7F3N2O2S and a molecular weight of 288.25 g/mol. IUPAC name: 2-[4-(trifluoromethyl)anilino]-1,3-thiazole-5-carboxylic acid. InChIKey: JQYRLNYJRPJVLG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7F3N2O2S
Molecular weight288.25 g/mol
IUPAC name2-[4-(trifluoromethyl)anilino]-1,3-thiazole-5-carboxylic acid
InChIKeyJQYRLNYJRPJVLG-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(F)(F)F)NC2=NC=C(S2)C(=O)O

Computed by PubChem (NCBI)