CAS 1172521-22-0 appears in our catalog under these names: 4-(Cyclopentyloxy)aniline hydrochloride, 95%, 4-(Cyclopentyloxy)aniline hydrochloride, 98%, 4-(Cyclopentyloxy)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
4-cyclopentyloxyaniline;hydrochloride (CAS 1172521-22-0) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 4-cyclopentyloxyaniline;hydrochloride. InChIKey: UXKDWLSFAQUFRH-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 4-cyclopentyloxyaniline;hydrochloride |
| InChIKey | UXKDWLSFAQUFRH-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)