CAS 1172703-11-5 is the registry number for Sodium 1-(prop-2-en-1-yl)-1h-imidazole-2-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Sodium 1-prop-2-enylimidazole-2-carboxylate (CAS 1172703-11-5) is a chemical compound with the molecular formula C7H7N2NaO2 and a molecular weight of 174.13 g/mol. IUPAC name: sodium 1-prop-2-enylimidazole-2-carboxylate. InChIKey: ITJLEYCDAOYKES-UHFFFAOYSA-M.
| Molecular formula | C7H7N2NaO2 |
|---|---|
| Molecular weight | 174.13 g/mol |
| IUPAC name | sodium 1-prop-2-enylimidazole-2-carboxylate |
| InChIKey | ITJLEYCDAOYKES-UHFFFAOYSA-M |
| SMILES | C=CCN1C=CN=C1C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)