CAS 2044713-66-6 appears in our catalog under these names: Sodium 2-(pyrazin-2-yl)propanoate, 95%, Sodium 2-(pyrazin-2-yl)propanoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
Sodium 2-pyrazin-2-ylpropanoate (CAS 2044713-66-6) is a chemical compound with the molecular formula C7H7N2NaO2 and a molecular weight of 174.13 g/mol. IUPAC name: sodium 2-pyrazin-2-ylpropanoate. InChIKey: URDYATHKUIYYQD-UHFFFAOYSA-M.
| Molecular formula | C7H7N2NaO2 |
|---|---|
| Molecular weight | 174.13 g/mol |
| IUPAC name | sodium 2-pyrazin-2-ylpropanoate |
| InChIKey | URDYATHKUIYYQD-UHFFFAOYSA-M |
| SMILES | CC(C1=NC=CN=C1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)