CAS 1172827-44-9 is the registry number for 1-(2,4,6-Trimethylbenzyl)-1H-pyrrole-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2,4,6-trimethylphenyl)methyl]pyrrole-2-carbonitrile (CAS 1172827-44-9) is a chemical compound with the molecular formula C15H16N2 and a molecular weight of 224.30 g/mol. IUPAC name: 1-[(2,4,6-trimethylphenyl)methyl]pyrrole-2-carbonitrile. InChIKey: NPEFFJTVTOJYJC-UHFFFAOYSA-N.
| Molecular formula | C15H16N2 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 1-[(2,4,6-trimethylphenyl)methyl]pyrrole-2-carbonitrile |
| InChIKey | NPEFFJTVTOJYJC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CN2C=CC=C2C#N)C |
Computed by PubChem (NCBI)