CAS 1172878-64-6 is the registry number for 6-Methyl-3-(trimethyl-1H-pyrazol-4-yl)-(1,2)oxazolo(5,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-methyl-3-(1,3,5-trimethylpyrazol-4-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CAS 1172878-64-6) is a chemical compound with the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. IUPAC name: 6-methyl-3-(1,3,5-trimethylpyrazol-4-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: QVZVMXGWZOCLFB-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O3 |
|---|---|
| Molecular weight | 286.29 g/mol |
| IUPAC name | 6-methyl-3-(1,3,5-trimethylpyrazol-4-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | QVZVMXGWZOCLFB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=NOC2=N1)C3=C(N(N=C3C)C)C)C(=O)O |
Computed by PubChem (NCBI)