CAS 157673-16-0 is the registry number for 7-(Diethylamino)coumarin-3-carbonyl Azide, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg, 50mg.
7-(diethylamino)-2-oxochromene-3-carbonyl azide (CAS 157673-16-0) is a chemical compound with the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. IUPAC name: 7-(diethylamino)-2-oxochromene-3-carbonyl azide. InChIKey: FJIQMYGHCNXCHE-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O3 |
|---|---|
| Molecular weight | 286.29 g/mol |
| IUPAC name | 7-(diethylamino)-2-oxochromene-3-carbonyl azide |
| InChIKey | FJIQMYGHCNXCHE-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)N=[N+]=[N-] |
Computed by PubChem (NCBI)