CAS 1202864-61-6 is the registry number for 1H-Pyrrolo[2,3-b]pyridine 7-oxide hemihydrate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
Bis(7-hydroxypyrrolo[2,3-b]pyridine);hydrate (CAS 1202864-61-6) is a chemical compound with the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. IUPAC name: bis(7-hydroxypyrrolo[2,3-b]pyridine);hydrate. InChIKey: OHKTXWVCKFOLSU-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O3 |
|---|---|
| Molecular weight | 286.29 g/mol |
| IUPAC name | bis(7-hydroxypyrrolo[2,3-b]pyridine);hydrate |
| InChIKey | OHKTXWVCKFOLSU-UHFFFAOYSA-N |
| SMILES | C1=CN(C2=NC=CC2=C1)O.C1=CN(C2=NC=CC2=C1)O.O |
Computed by PubChem (NCBI)