Products 1172891-02-9

CAS 1172891-02-9 is the registry number for 3-(4-(Pyridin-2-yl)piperazin-1-yl)propanoic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

3-(4-pyridin-2-ylpiperazin-1-yl)propanoic acid;dihydrochloride (CAS 1172891-02-9) is a chemical compound with the molecular formula C12H19Cl2N3O2 and a molecular weight of 308.20 g/mol. IUPAC name: 3-(4-pyridin-2-ylpiperazin-1-yl)propanoic acid;dihydrochloride. InChIKey: DLSPGHAZUBNVKS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19Cl2N3O2
Molecular weight308.20 g/mol
IUPAC name3-(4-pyridin-2-ylpiperazin-1-yl)propanoic acid;dihydrochloride
InChIKeyDLSPGHAZUBNVKS-UHFFFAOYSA-N
SMILESC1CN(CCN1CCC(=O)O)C2=CC=CC=N2.Cl.Cl

Computed by PubChem (NCBI)