CAS 361462-70-6 is the registry number for N-(2-Chloro-4-nitrophenyl)hexane-1,6-diamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N'-(2-chloro-4-nitrophenyl)hexane-1,6-diamine;hydrochloride (CAS 361462-70-6) is a chemical compound with the molecular formula C12H19Cl2N3O2 and a molecular weight of 308.20 g/mol. IUPAC name: N'-(2-chloro-4-nitrophenyl)hexane-1,6-diamine;hydrochloride. InChIKey: XXSXYRKCXKDSIE-UHFFFAOYSA-N.
| Molecular formula | C12H19Cl2N3O2 |
|---|---|
| Molecular weight | 308.20 g/mol |
| IUPAC name | N'-(2-chloro-4-nitrophenyl)hexane-1,6-diamine;hydrochloride |
| InChIKey | XXSXYRKCXKDSIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)NCCCCCCN.Cl |
Computed by PubChem (NCBI)