CAS 1172936-72-9 is the registry number for 1-(4-(2,4-Dichlorophenyl)-1,3-thiazol-2-yl)-3-methyl-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-5-methylpyrazole-3-carboxylic acid (CAS 1172936-72-9) is a chemical compound with the molecular formula C14H9Cl2N3O2S and a molecular weight of 354.2 g/mol. IUPAC name: 2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-5-methylpyrazole-3-carboxylic acid. InChIKey: SEDVNFJJUFUJPZ-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2N3O2S |
|---|---|
| Molecular weight | 354.2 g/mol |
| IUPAC name | 2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-5-methylpyrazole-3-carboxylic acid |
| InChIKey | SEDVNFJJUFUJPZ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(=O)O)C2=NC(=CS2)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)