Products 2685795-52-0
CAS 2685795-52-0 appears in our catalog under these names: SDH-IN-1, SDH–IN–1, SDH-IN-1, 99.95%, SDH-IN-1, 98%, N-(3,4-Dichlorobenzyl)-5-(thiophen-2-yl)-1,3,4-oxadiazole-2-carboxamide, 98%. Offered by: TargetMol, GLPBio, MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 2mg, 10mg, 100mg, 25mg, 5mg, 50mg, 10 mg, 10mM/1mL.
N-[(3,4-dichlorophenyl)methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-carboxamide (CAS 2685795-52-0) is a chemical compound with the molecular formula C14H9Cl2N3O2S and a molecular weight of 354.2 g/mol. IUPAC name: N-[(3,4-dichlorophenyl)methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-carboxamide. InChIKey: VHRCPMTYUKLSDU-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2N3O2S |
|---|---|
| Molecular weight | 354.2 g/mol |
| IUPAC name | N-[(3,4-dichlorophenyl)methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-carboxamide |
| InChIKey | VHRCPMTYUKLSDU-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NN=C(O2)C(=O)NCC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)