Products 1173018-70-6
CAS 1173018-70-6 is the registry number for 4-Bromobenzenamine-1,2,3,4,5,6-13C6. Offered by: TRC. Available pack sizes: 100mg.
4-bromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine (CAS 1173018-70-6) is a chemical compound with the molecular formula C6H6BrN and a molecular weight of 177.98 g/mol. IUPAC name: 4-bromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine. InChIKey: WDFQBORIUYODSI-IDEBNGHGSA-N.
| Molecular formula | C6H6BrN |
|---|---|
| Molecular weight | 177.98 g/mol |
| IUPAC name | 4-bromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine |
| InChIKey | WDFQBORIUYODSI-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1N)Br |
Computed by PubChem (NCBI)