Products 61357-76-4
CAS 61357-76-4 appears in our catalog under these names: 4-Bromoaniline-d4, 99.91%, 4-Bromoaniline-2,3,5,6-d4, >95% (HPLC), 4-Bromoaniline-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, TRC, CDN. Available pack sizes: 500 mg, 100 mg, 250 mg, 1 g, 5 g, 100mg, 250mg, 50mg.
4-bromo-2,3,5,6-tetradeuterioaniline (CAS 61357-76-4) is a chemical compound with the molecular formula C6H6BrN and a molecular weight of 176.05 g/mol. IUPAC name: 4-bromo-2,3,5,6-tetradeuterioaniline. InChIKey: WDFQBORIUYODSI-RHQRLBAQSA-N.
| Molecular formula | C6H6BrN |
|---|---|
| Molecular weight | 176.05 g/mol |
| IUPAC name | 4-bromo-2,3,5,6-tetradeuterioaniline |
| InChIKey | WDFQBORIUYODSI-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)